C10H22BNO7S — CID 171717112
1-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]-2-oxoboranylsulfonylethane-1,2-diol (PubChem CID 171717112) has the molecular formula C10H22BNO7S and a molecular weight of 311.17 g/mol. Its IUPAC name is 1-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]-2-oxoboranylsulfonylethane-1,2-diol.
| Compound Name | 1-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]-2-oxoboranylsulfonylethane-1,2-diol |
|---|---|
| PubChem CID | 171717112 |
| Molecular Formula | C10H22BNO7S |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]-2-oxoboranylsulfonylethane-1,2-diol |
| SMILES | CC(C)CC(CO)N(CCO)C(O)C(O)S(=O)(=O)B=O |
| InChI | InChI=1S/C10H22BNO7S/c1-7(2)5-8(6-14)12(3-4-13)9(15)10(16)20(18,19)11-17/h7-10,13-16H,3-6H2,1-2H3 |
| InChIKey | YVQVROBCTTTWCD-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|