C12H25NO3S — CID 153298656
N-cyclopropyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]propane-2-sulfonamide (PubChem CID 153298656) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]propane-2-sulfonamide.
| Compound Name | N-cyclopropyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 153298656 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-cyclopropyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]propane-2-sulfonamide |
| SMILES | CC(C)C[C@@H](CO)N(C1CC1)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C12H25NO3S/c1-9(2)7-12(8-14)13(11-5-6-11)17(15,16)10(3)4/h9-12,14H,5-8H2,1-4H3/t12-/m0/s1 |
| InChIKey | GTEXHTAZZAJRFJ-LBPRGKRZSA-N |
| XLogP | 1.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |