C14H29NO3S — CID 153306604
N-(cyclopropylmethyl)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]propane-2-sulfonamide (PubChem CID 153306604) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]propane-2-sulfonamide.
| Compound Name | N-(cyclopropylmethyl)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 153306604 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]propane-2-sulfonamide |
| SMILES | CC(C)CC[C@H](CO)N(CC1CC1)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C14H29NO3S/c1-11(2)5-8-14(10-16)15(9-13-6-7-13)19(17,18)12(3)4/h11-14,16H,5-10H2,1-4H3/t14-/m1/s1 |
| InChIKey | PLVPOMNUHNPSEZ-CQSZACIVSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |