C8H19NO3S — CID 60865128
N-(2-hydroxyethyl)-N-propan-2-ylpropane-2-sulfonamide (PubChem CID 60865128) has the molecular formula C8H19NO3S and a molecular weight of 209.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-propan-2-ylpropane-2-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N-propan-2-ylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 60865128 |
| Molecular Formula | C8H19NO3S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-(2-hydroxyethyl)-N-propan-2-ylpropane-2-sulfonamide |
| SMILES | CC(C)N(CCO)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C8H19NO3S/c1-7(2)9(5-6-10)13(11,12)8(3)4/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | TUCMSDHNGWTOKW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |