C9H16N4O3S — CID 62153161
2-amino-N-(2-hydroxyethyl)-N-propan-2-ylpyrimidine-5-sulfonamide (PubChem CID 62153161) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxyethyl)-N-propan-2-ylpyrimidine-5-sulfonamide.
| Compound Name | 2-amino-N-(2-hydroxyethyl)-N-propan-2-ylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62153161 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-amino-N-(2-hydroxyethyl)-N-propan-2-ylpyrimidine-5-sulfonamide |
| SMILES | CC(C)N(CCO)S(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C9H16N4O3S/c1-7(2)13(3-4-14)17(15,16)8-5-11-9(10)12-6-8/h5-7,14H,3-4H2,1-2H3,(H2,10,11,12) |
| InChIKey | BXOAEYLPQKLDLC-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |