C10H18N2O3S — CID 43574724
N-(2-hydroxyethyl)-1-methyl-N-propan-2-ylpyrrole-3-sulfonamide (PubChem CID 43574724) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1-methyl-N-propan-2-ylpyrrole-3-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-1-methyl-N-propan-2-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 43574724 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(2-hydroxyethyl)-1-methyl-N-propan-2-ylpyrrole-3-sulfonamide |
| SMILES | CC(C)N(CCO)S(=O)(=O)c1ccn(C)c1 |
| InChI | InChI=1S/C10H18N2O3S/c1-9(2)12(6-7-13)16(14,15)10-4-5-11(3)8-10/h4-5,8-9,13H,6-7H2,1-3H3 |
| InChIKey | CMJYFGKJCWBIJP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |