C12H18FNO4S — CID 43574658
3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-propan-2-ylbenzenesulfonamide (PubChem CID 43574658) has the molecular formula C12H18FNO4S and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 43574658 |
| Molecular Formula | C12H18FNO4S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCO)C(C)C)cc1F |
| InChI | InChI=1S/C12H18FNO4S/c1-9(2)14(6-7-15)19(16,17)10-4-5-12(18-3)11(13)8-10/h4-5,8-9,15H,6-7H2,1-3H3 |
| InChIKey | ISNYCZPSQJCBEO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |