C10H16N2O4S — CID 43294368
4-[methyl-(1-methylpyrrol-3-yl)sulfonylamino]butanoic acid (PubChem CID 43294368) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-[methyl-(1-methylpyrrol-3-yl)sulfonylamino]butanoic acid.
| Compound Name | 4-[methyl-(1-methylpyrrol-3-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43294368 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-[methyl-(1-methylpyrrol-3-yl)sulfonylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)S(=O)(=O)c1ccn(C)c1 |
| InChI | InChI=1S/C10H16N2O4S/c1-11-7-5-9(8-11)17(15,16)12(2)6-3-4-10(13)14/h5,7-8H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | ZAJXQSYRRZDJHK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |