C8H12N2O4S — CID 12037818
3-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid (PubChem CID 12037818) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid.
| Compound Name | 3-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 12037818 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid |
| SMILES | CN(CCC(=O)O)S(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C8H12N2O4S/c1-10(5-3-8(11)12)15(13,14)7-2-4-9-6-7/h2,4,6,9H,3,5H2,1H3,(H,11,12) |
| InChIKey | RUYSBUISIKWZLX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |