C8H11N3O5S — CID 107435842
2-[(2-amino-2-oxoethyl)-(1H-pyrrol-3-ylsulfonyl)amino]acetic acid (PubChem CID 107435842) has the molecular formula C8H11N3O5S and a molecular weight of 261.26 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(1H-pyrrol-3-ylsulfonyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(1H-pyrrol-3-ylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 107435842 |
| Molecular Formula | C8H11N3O5S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(1H-pyrrol-3-ylsulfonyl)amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)S(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C8H11N3O5S/c9-7(12)4-11(5-8(13)14)17(15,16)6-1-2-10-3-6/h1-3,10H,4-5H2,(H2,9,12)(H,13,14) |
| InChIKey | GATNURKLFJWYMZ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |