C9H10FN3O5S — CID 107435853
2-[(2-amino-2-oxoethyl)-[(3-fluoro-2-pyridinyl)sulfonyl]amino]acetic acid (PubChem CID 107435853) has the molecular formula C9H10FN3O5S and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(3-fluoro-2-pyridinyl)sulfonyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(3-fluoro-2-pyridinyl)sulfonyl]amino]acetic acid |
|---|---|
| PubChem CID | 107435853 |
| Molecular Formula | C9H10FN3O5S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(3-fluoro-2-pyridinyl)sulfonyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)S(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C9H10FN3O5S/c10-6-2-1-3-12-9(6)19(17,18)13(4-7(11)14)5-8(15)16/h1-3H,4-5H2,(H2,11,14)(H,15,16) |
| InChIKey | OWWUIQHWZLPXTJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |