C15H25FN2O2S — CID 103299737
3-fluoro-N,N-dipentylpyridine-2-sulfonamide (PubChem CID 103299737) has the molecular formula C15H25FN2O2S and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-fluoro-N,N-dipentylpyridine-2-sulfonamide.
| Compound Name | 3-fluoro-N,N-dipentylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103299737 |
| Molecular Formula | C15H25FN2O2S |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-fluoro-N,N-dipentylpyridine-2-sulfonamide |
| SMILES | CCCCCN(CCCCC)S(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C15H25FN2O2S/c1-3-5-7-12-18(13-8-6-4-2)21(19,20)15-14(16)10-9-11-17-15/h9-11H,3-8,12-13H2,1-2H3 |
| InChIKey | MIWBEXAIBAGSMK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|