C15H27N3O2S — CID 103304336
N,N-dibutyl-3-(ethylamino)pyridine-2-sulfonamide (PubChem CID 103304336) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N,N-dibutyl-3-(ethylamino)pyridine-2-sulfonamide.
| Compound Name | N,N-dibutyl-3-(ethylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103304336 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N,N-dibutyl-3-(ethylamino)pyridine-2-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ncccc1NCC |
| InChI | InChI=1S/C15H27N3O2S/c1-4-7-12-18(13-8-5-2)21(19,20)15-14(16-6-3)10-9-11-17-15/h9-11,16H,4-8,12-13H2,1-3H3 |
| InChIKey | OCBZPYFFMHCIHJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |