C13H18N4O2S — CID 103305242
N-(2-cyanoethyl)-N-cyclopropyl-3-(ethylamino)pyridine-2-sulfonamide (PubChem CID 103305242) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-cyclopropyl-3-(ethylamino)pyridine-2-sulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-cyclopropyl-3-(ethylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103305242 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(2-cyanoethyl)-N-cyclopropyl-3-(ethylamino)pyridine-2-sulfonamide |
| SMILES | CCNc1cccnc1S(=O)(=O)N(CCC#N)C1CC1 |
| InChI | InChI=1S/C13H18N4O2S/c1-2-15-12-5-3-9-16-13(12)20(18,19)17(10-4-8-14)11-6-7-11/h3,5,9,11,15H,2,4,6-7,10H2,1H3 |
| InChIKey | RKXIDHVWBKAFTI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |