C12H21N3O2S — CID 103303638
N,N-diethyl-3-(propylamino)pyridine-2-sulfonamide (PubChem CID 103303638) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N,N-diethyl-3-(propylamino)pyridine-2-sulfonamide.
| Compound Name | N,N-diethyl-3-(propylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103303638 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N,N-diethyl-3-(propylamino)pyridine-2-sulfonamide |
| SMILES | CCCNc1cccnc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C12H21N3O2S/c1-4-9-13-11-8-7-10-14-12(11)18(16,17)15(5-2)6-3/h7-8,10,13H,4-6,9H2,1-3H3 |
| InChIKey | TUTGBFAUKUEHOQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |