C12H16FN3O2S2 — CID 103300682
2-[cyclopentyl-[(3-fluoro-2-pyridinyl)sulfonyl]amino]ethanethioamide (PubChem CID 103300682) has the molecular formula C12H16FN3O2S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-[cyclopentyl-[(3-fluoro-2-pyridinyl)sulfonyl]amino]ethanethioamide.
| Compound Name | 2-[cyclopentyl-[(3-fluoro-2-pyridinyl)sulfonyl]amino]ethanethioamide |
|---|---|
| PubChem CID | 103300682 |
| Molecular Formula | C12H16FN3O2S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[cyclopentyl-[(3-fluoro-2-pyridinyl)sulfonyl]amino]ethanethioamide |
| SMILES | NC(=S)CN(C1CCCC1)S(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C12H16FN3O2S2/c13-10-6-3-7-15-12(10)20(17,18)16(8-11(14)19)9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8H2,(H2,14,19) |
| InChIKey | HAZHAHVRLALRSB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|