C11H14FN3O2S2 — CID 103300677
1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-2-carbothioamide (PubChem CID 103300677) has the molecular formula C11H14FN3O2S2 and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-2-carbothioamide.
| Compound Name | 1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-2-carbothioamide |
|---|---|
| PubChem CID | 103300677 |
| Molecular Formula | C11H14FN3O2S2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidine-2-carbothioamide |
| SMILES | NC(=S)C1CCCCN1S(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C11H14FN3O2S2/c12-8-4-3-6-14-11(8)19(16,17)15-7-2-1-5-9(15)10(13)18/h3-4,6,9H,1-2,5,7H2,(H2,13,18) |
| InChIKey | XSTMBKMNYOPHBB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|