C12H16FN3O2S3 — CID 103300684
1-[(3-fluoro-2-pyridinyl)sulfonyl]-4-methylsulfanylpiperidine-4-carbothioamide (PubChem CID 103300684) has the molecular formula C12H16FN3O2S3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[(3-fluoro-2-pyridinyl)sulfonyl]-4-methylsulfanylpiperidine-4-carbothioamide.
| Compound Name | 1-[(3-fluoro-2-pyridinyl)sulfonyl]-4-methylsulfanylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 103300684 |
| Molecular Formula | C12H16FN3O2S3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1-[(3-fluoro-2-pyridinyl)sulfonyl]-4-methylsulfanylpiperidine-4-carbothioamide |
| SMILES | CSC1(C(N)=S)CCN(S(=O)(=O)c2ncccc2F)CC1 |
| InChI | InChI=1S/C12H16FN3O2S3/c1-20-12(11(14)19)4-7-16(8-5-12)21(17,18)10-9(13)3-2-6-15-10/h2-3,6H,4-5,7-8H2,1H3,(H2,14,19) |
| InChIKey | XPDNFUXXIIDTSA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|