C12H16BrFN2O2S — CID 103308267
N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridine-2-sulfonamide (PubChem CID 103308267) has the molecular formula C12H16BrFN2O2S and a molecular weight of 351.24 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103308267 |
| Molecular Formula | C12H16BrFN2O2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridine-2-sulfonamide |
| SMILES | O=S(=O)(c1ncccc1F)N(CCBr)C1CCCC1 |
| InChI | InChI=1S/C12H16BrFN2O2S/c13-7-9-16(10-4-1-2-5-10)19(17,18)12-11(14)6-3-8-15-12/h3,6,8,10H,1-2,4-5,7,9H2 |
| InChIKey | IZFMLZABLWXVBN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|