C12H16BrFN2 — CID 80669537
N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridin-2-amine (PubChem CID 80669537) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridin-2-amine.
| Compound Name | N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 80669537 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopentyl-3-fluoropyridin-2-amine |
| SMILES | Fc1cccnc1N(CCBr)C1CCCC1 |
| InChI | InChI=1S/C12H16BrFN2/c13-7-9-16(10-4-1-2-5-10)12-11(14)6-3-8-15-12/h3,6,8,10H,1-2,4-5,7,9H2 |
| InChIKey | VKLAOVSJTPCMSO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|