C9H10BrF3N2 — CID 107489652
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine (PubChem CID 107489652) has the molecular formula C9H10BrF3N2 and a molecular weight of 283.09 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 107489652 |
| Molecular Formula | C9H10BrF3N2 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine |
| SMILES | Fc1cccnc1N(CCBr)CC(F)F |
| InChI | InChI=1S/C9H10BrF3N2/c10-3-5-15(6-8(12)13)9-7(11)2-1-4-14-9/h1-2,4,8H,3,5-6H2 |
| InChIKey | RGMSHMGXUSXBPZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|