C10H12Br2F2N2 — CID 107489338
3-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine (PubChem CID 107489338) has the molecular formula C10H12Br2F2N2 and a molecular weight of 358.02 g/mol. Its IUPAC name is 3-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107489338 |
| Molecular Formula | C10H12Br2F2N2 |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 3-bromo-N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N(CCBr)CC(F)F)c1Br |
| InChI | InChI=1S/C10H12Br2F2N2/c1-7-2-4-15-10(9(7)12)16(5-3-11)6-8(13)14/h2,4,8H,3,5-6H2,1H3 |
| InChIKey | ZGUFAJUBJYIEKF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|