About 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine
3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine (PubChem CID 106876953) has the molecular formula C12H19BrN2
and a molecular weight of 271.20 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine |
| PubChem CID | 106876953 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine |
| SMILES | Cc1ccnc(N(C)CC(C)(C)C)c1Br |
| InChI | InChI=1S/C12H19BrN2/c1-9-6-7-14-11(10(9)13)15(5)8-12(2,3)4/h6-7H,8H2,1-5H3 |
| InChIKey | PLMLCDKNIBBOBF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine?
The IUPAC name of 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine (CID 106876953) is 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine.
What is the SMILES notation for 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine?
The canonical SMILES for 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine is Cc1ccnc(N(C)CC(C)(C)C)c1Br.
What is the InChIKey of 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine?
The InChIKey is PLMLCDKNIBBOBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN2/c1-9-6-7-14-11(10(9)13)15(5)8-12(2,3)4/h6-7H,8H2,1-5H3.
What are the key properties of 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine?
3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine has a molecular weight of 271.20 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2,2-dimethylpropyl)-N,4-dimethylpyridin-2-amine is sourced from PubChem (CID 106876953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).