C16H19BrN2 — CID 106876609
3-bromo-N,4-dimethyl-N-(3-phenylpropyl)pyridin-2-amine (PubChem CID 106876609) has the molecular formula C16H19BrN2 and a molecular weight of 319.25 g/mol. Its IUPAC name is 3-bromo-N,4-dimethyl-N-(3-phenylpropyl)pyridin-2-amine.
| Compound Name | 3-bromo-N,4-dimethyl-N-(3-phenylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106876609 |
| Molecular Formula | C16H19BrN2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-bromo-N,4-dimethyl-N-(3-phenylpropyl)pyridin-2-amine |
| SMILES | Cc1ccnc(N(C)CCCc2ccccc2)c1Br |
| InChI | InChI=1S/C16H19BrN2/c1-13-10-11-18-16(15(13)17)19(2)12-6-9-14-7-4-3-5-8-14/h3-5,7-8,10-11H,6,9,12H2,1-2H3 |
| InChIKey | NUGUBEHJWLNRQH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |