C9H12FN3O2S2 — CID 103300665
4-[(3-fluoro-2-pyridinyl)sulfonylamino]butanethioamide (PubChem CID 103300665) has the molecular formula C9H12FN3O2S2 and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-[(3-fluoro-2-pyridinyl)sulfonylamino]butanethioamide.
| Compound Name | 4-[(3-fluoro-2-pyridinyl)sulfonylamino]butanethioamide |
|---|---|
| PubChem CID | 103300665 |
| Molecular Formula | C9H12FN3O2S2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-[(3-fluoro-2-pyridinyl)sulfonylamino]butanethioamide |
| SMILES | NC(=S)CCCNS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C9H12FN3O2S2/c10-7-3-1-5-12-9(7)17(14,15)13-6-2-4-8(11)16/h1,3,5,13H,2,4,6H2,(H2,11,16) |
| InChIKey | RVHGGOAGYHGJHX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|