C9H14FN3O4S2 — CID 114175137
N-[2-(ethylsulfamoyl)ethyl]-3-fluoropyridine-2-sulfonamide (PubChem CID 114175137) has the molecular formula C9H14FN3O4S2 and a molecular weight of 311.36 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 114175137 |
| Molecular Formula | C9H14FN3O4S2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-3-fluoropyridine-2-sulfonamide |
| SMILES | CCNS(=O)(=O)CCNS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C9H14FN3O4S2/c1-2-12-18(14,15)7-6-13-19(16,17)9-8(10)4-3-5-11-9/h3-5,12-13H,2,6-7H2,1H3 |
| InChIKey | LWYHDVDIXNJKBM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |