C9H12BrFN2O2S — CID 103308428
N-(2-bromobutyl)-3-fluoropyridine-2-sulfonamide (PubChem CID 103308428) has the molecular formula C9H12BrFN2O2S and a molecular weight of 311.18 g/mol. Its IUPAC name is N-(2-bromobutyl)-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-(2-bromobutyl)-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103308428 |
| Molecular Formula | C9H12BrFN2O2S |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | N-(2-bromobutyl)-3-fluoropyridine-2-sulfonamide |
| SMILES | CCC(Br)CNS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C9H12BrFN2O2S/c1-2-7(10)6-13-16(14,15)9-8(11)4-3-5-12-9/h3-5,7,13H,2,6H2,1H3 |
| InChIKey | POCUJPCIGOZNCI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|