C12H19FN2O2S2 — CID 114115952
N-(2-ethyl-2-methylsulfanylbutyl)-3-fluoropyridine-2-sulfonamide (PubChem CID 114115952) has the molecular formula C12H19FN2O2S2 and a molecular weight of 306.43 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 114115952 |
| Molecular Formula | C12H19FN2O2S2 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)-3-fluoropyridine-2-sulfonamide |
| SMILES | CCC(CC)(CNS(=O)(=O)c1ncccc1F)SC |
| InChI | InChI=1S/C12H19FN2O2S2/c1-4-12(5-2,18-3)9-15-19(16,17)11-10(13)7-6-8-14-11/h6-8,15H,4-5,9H2,1-3H3 |
| InChIKey | FWBKKOZFTGRZKG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |