C13H20FNO2S2 — CID 113242756
N-(2-ethyl-2-methylsulfanylbutyl)-4-fluorobenzenesulfonamide (PubChem CID 113242756) has the molecular formula C13H20FNO2S2 and a molecular weight of 305.44 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113242756 |
| Molecular Formula | C13H20FNO2S2 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)-4-fluorobenzenesulfonamide |
| SMILES | CCC(CC)(CNS(=O)(=O)c1ccc(F)cc1)SC |
| InChI | InChI=1S/C13H20FNO2S2/c1-4-13(5-2,18-3)10-15-19(16,17)12-8-6-11(14)7-9-12/h6-9,15H,4-5,10H2,1-3H3 |
| InChIKey | RNZVRENBZLHYOZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |