C9H11FN2O4S — CID 103299284
ethyl 2-[(3-fluoro-2-pyridinyl)sulfonylamino]acetate (PubChem CID 103299284) has the molecular formula C9H11FN2O4S and a molecular weight of 262.26 g/mol. Its IUPAC name is ethyl 2-[(3-fluoro-2-pyridinyl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[(3-fluoro-2-pyridinyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 103299284 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | ethyl 2-[(3-fluoro-2-pyridinyl)sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C9H11FN2O4S/c1-2-16-8(13)6-12-17(14,15)9-7(10)4-3-5-11-9/h3-5,12H,2,6H2,1H3 |
| InChIKey | PEELMPRKCZWDDZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |