C12H17FN2O2S2 — CID 114115960
3-fluoro-N-[(1-methylsulfanylcyclopentyl)methyl]pyridine-2-sulfonamide (PubChem CID 114115960) has the molecular formula C12H17FN2O2S2 and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-fluoro-N-[(1-methylsulfanylcyclopentyl)methyl]pyridine-2-sulfonamide.
| Compound Name | 3-fluoro-N-[(1-methylsulfanylcyclopentyl)methyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 114115960 |
| Molecular Formula | C12H17FN2O2S2 |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-fluoro-N-[(1-methylsulfanylcyclopentyl)methyl]pyridine-2-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2ncccc2F)CCCC1 |
| InChI | InChI=1S/C12H17FN2O2S2/c1-18-12(6-2-3-7-12)9-15-19(16,17)11-10(13)5-4-8-14-11/h4-5,8,15H,2-3,6-7,9H2,1H3 |
| InChIKey | MQTGMWPNEFEZPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |