C10H13FN2O2S — CID 103300453
3-fluoro-N-(1-methylcyclobutyl)pyridine-2-sulfonamide (PubChem CID 103300453) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-fluoro-N-(1-methylcyclobutyl)pyridine-2-sulfonamide.
| Compound Name | 3-fluoro-N-(1-methylcyclobutyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103300453 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-fluoro-N-(1-methylcyclobutyl)pyridine-2-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2ncccc2F)CCC1 |
| InChI | InChI=1S/C10H13FN2O2S/c1-10(5-3-6-10)13-16(14,15)9-8(11)4-2-7-12-9/h2,4,7,13H,3,5-6H2,1H3 |
| InChIKey | DDWGKFRVOOFHEK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |