C10H14FN3O2S — CID 103308604
N-[1-(aminomethyl)cyclobutyl]-3-fluoropyridine-2-sulfonamide (PubChem CID 103308604) has the molecular formula C10H14FN3O2S and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclobutyl]-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-[1-(aminomethyl)cyclobutyl]-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103308604 |
| Molecular Formula | C10H14FN3O2S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[1-(aminomethyl)cyclobutyl]-3-fluoropyridine-2-sulfonamide |
| SMILES | NCC1(NS(=O)(=O)c2ncccc2F)CCC1 |
| InChI | InChI=1S/C10H14FN3O2S/c11-8-3-1-6-13-9(8)17(15,16)14-10(7-12)4-2-5-10/h1,3,6,14H,2,4-5,7,12H2 |
| InChIKey | HJADDSSJKXONSF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |