C12H20FN3O2S — CID 107158974
N-(2-amino-4,4-dimethylpentyl)-3-fluoropyridine-2-sulfonamide (PubChem CID 107158974) has the molecular formula C12H20FN3O2S and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2-amino-4,4-dimethylpentyl)-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-(2-amino-4,4-dimethylpentyl)-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 107158974 |
| Molecular Formula | C12H20FN3O2S |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(2-amino-4,4-dimethylpentyl)-3-fluoropyridine-2-sulfonamide |
| SMILES | CC(C)(C)CC(N)CNS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C12H20FN3O2S/c1-12(2,3)7-9(14)8-16-19(17,18)11-10(13)5-4-6-15-11/h4-6,9,16H,7-8,14H2,1-3H3 |
| InChIKey | MULKADASAPBMRK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |