C8H12N2O4S — CID 62626598
2-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid (PubChem CID 62626598) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid.
| Compound Name | 2-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62626598 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-[methyl(1H-pyrrol-3-ylsulfonyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)S(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C8H12N2O4S/c1-6(8(11)12)10(2)15(13,14)7-3-4-9-5-7/h3-6,9H,1-2H3,(H,11,12) |
| InChIKey | XBWLSFOZNXPYSC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |