C10H11BrFNO4S — CID 55096582
2-[(2-bromo-4-fluorophenyl)sulfonyl-methylamino]propanoic acid (PubChem CID 55096582) has the molecular formula C10H11BrFNO4S and a molecular weight of 340.17 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)sulfonyl-methylamino]propanoic acid.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)sulfonyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 55096582 |
| Molecular Formula | C10H11BrFNO4S |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)sulfonyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C10H11BrFNO4S/c1-6(10(14)15)13(2)18(16,17)9-4-3-7(12)5-8(9)11/h3-6H,1-2H3,(H,14,15) |
| InChIKey | GCGMHWWBLCRIPO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |