C14H22BrFN2O2S — CID 61059512
2-bromo-N-[2-(dimethylamino)ethyl]-4-fluoro-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 61059512) has the molecular formula C14H22BrFN2O2S and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-bromo-N-[2-(dimethylamino)ethyl]-4-fluoro-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(dimethylamino)ethyl]-4-fluoro-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61059512 |
| Molecular Formula | C14H22BrFN2O2S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-bromo-N-[2-(dimethylamino)ethyl]-4-fluoro-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CCN(C)C)S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H22BrFN2O2S/c1-11(2)10-18(8-7-17(3)4)21(19,20)14-6-5-12(16)9-13(14)15/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | WEXIUPIVDGTRKY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |