C10H8F5NO4S — CID 135241801
2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid (PubChem CID 135241801) has the molecular formula C10H8F5NO4S and a molecular weight of 333.23 g/mol. Its IUPAC name is 2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 135241801 |
| Molecular Formula | C10H8F5NO4S |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H8F5NO4S/c1-3(10(17)18)16(2)21(19,20)9-7(14)5(12)4(11)6(13)8(9)15/h3H,1-2H3,(H,17,18) |
| InChIKey | YHAZPESAGWFRTP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|