C12H12F3NO6S — CID 166431440
2-[1-carboxyethyl(methyl)sulfamoyl]-4-(trifluoromethyl)benzoic acid (PubChem CID 166431440) has the molecular formula C12H12F3NO6S and a molecular weight of 355.29 g/mol. Its IUPAC name is 2-[1-carboxyethyl(methyl)sulfamoyl]-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[1-carboxyethyl(methyl)sulfamoyl]-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 166431440 |
| Molecular Formula | C12H12F3NO6S |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 2-[1-carboxyethyl(methyl)sulfamoyl]-4-(trifluoromethyl)benzoic acid |
| SMILES | CC(C(=O)O)N(C)S(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C12H12F3NO6S/c1-6(10(17)18)16(2)23(21,22)9-5-7(12(13,14)15)3-4-8(9)11(19)20/h3-6H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | CLUISDFKAXVIED-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |