C10H10F3NO6S2 — CID 91042691
2-[bis(methylsulfonyl)amino]-4-(trifluoromethyl)benzoic acid (PubChem CID 91042691) has the molecular formula C10H10F3NO6S2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-[bis(methylsulfonyl)amino]-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[bis(methylsulfonyl)amino]-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 91042691 |
| Molecular Formula | C10H10F3NO6S2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-[bis(methylsulfonyl)amino]-4-(trifluoromethyl)benzoic acid |
| SMILES | CS(=O)(=O)N(c1cc(C(F)(F)F)ccc1C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C10H10F3NO6S2/c1-21(17,18)14(22(2,19)20)8-5-6(10(11,12)13)3-4-7(8)9(15)16/h3-5H,1-2H3,(H,15,16) |
| InChIKey | PWHRJYMSTPZKRV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |