C9H6F5NO4S — CID 10829415
2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid (PubChem CID 10829415) has the molecular formula C9H6F5NO4S and a molecular weight of 319.21 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 10829415 |
| Molecular Formula | C9H6F5NO4S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C9H6F5NO4S/c1-2(9(16)17)15-20(18,19)8-6(13)4(11)3(10)5(12)7(8)14/h2,15H,1H3,(H,16,17) |
| InChIKey | VAGZICJVOULMOI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|