C10H13NO4S2 — CID 122068116
2-[(2-methylsulfanylphenyl)sulfonylamino]propanoic acid (PubChem CID 122068116) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[(2-methylsulfanylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 2-[(2-methylsulfanylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 122068116 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-[(2-methylsulfanylphenyl)sulfonylamino]propanoic acid |
| SMILES | CSc1ccccc1S(=O)(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C10H13NO4S2/c1-7(10(12)13)11-17(14,15)9-6-4-3-5-8(9)16-2/h3-7,11H,1-2H3,(H,12,13) |
| InChIKey | GIXOSTWZVUSPDY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |