C10H11NO6S — CID 122068088
2-(1,3-benzodioxol-4-ylsulfonylamino)propanoic acid (PubChem CID 122068088) has the molecular formula C10H11NO6S and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-ylsulfonylamino)propanoic acid.
| Compound Name | 2-(1,3-benzodioxol-4-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 122068088 |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-(1,3-benzodioxol-4-ylsulfonylamino)propanoic acid |
| SMILES | CC(NS(=O)(=O)c1cccc2c1OCO2)C(=O)O |
| InChI | InChI=1S/C10H11NO6S/c1-6(10(12)13)11-18(14,15)8-4-2-3-7-9(8)17-5-16-7/h2-4,6,11H,5H2,1H3,(H,12,13) |
| InChIKey | GISCOCYBGMOZSU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |