C18H19NO6S — CID 120782389
4-(1,3-benzodioxol-4-ylsulfonylamino)-5-phenylpentanoic acid (PubChem CID 120782389) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-4-ylsulfonylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(1,3-benzodioxol-4-ylsulfonylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120782389 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-(1,3-benzodioxol-4-ylsulfonylamino)-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NS(=O)(=O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C18H19NO6S/c20-17(21)10-9-14(11-13-5-2-1-3-6-13)19-26(22,23)16-8-4-7-15-18(16)25-12-24-15/h1-8,14,19H,9-12H2,(H,20,21) |
| InChIKey | FKRHYGDREXKXAH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |