C16H23N3O4S — CID 122070983
4-[[1-cyanopropan-2-yl(methyl)sulfamoyl]amino]-5-phenylpentanoic acid (PubChem CID 122070983) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[1-cyanopropan-2-yl(methyl)sulfamoyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[1-cyanopropan-2-yl(methyl)sulfamoyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122070983 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[[1-cyanopropan-2-yl(methyl)sulfamoyl]amino]-5-phenylpentanoic acid |
| SMILES | CC(CC#N)N(C)S(=O)(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H23N3O4S/c1-13(10-11-17)19(2)24(22,23)18-15(8-9-16(20)21)12-14-6-4-3-5-7-14/h3-7,13,15,18H,8-10,12H2,1-2H3,(H,20,21) |
| InChIKey | CXGKJAHIMABMER-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |