C15H17NO5S — CID 120968808
4-(furan-3-ylsulfonylamino)-5-phenylpentanoic acid (PubChem CID 120968808) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-(furan-3-ylsulfonylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(furan-3-ylsulfonylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120968808 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-(furan-3-ylsulfonylamino)-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NS(=O)(=O)c1ccoc1 |
| InChI | InChI=1S/C15H17NO5S/c17-15(18)7-6-13(10-12-4-2-1-3-5-12)16-22(19,20)14-8-9-21-11-14/h1-5,8-9,11,13,16H,6-7,10H2,(H,17,18) |
| InChIKey | TVQGVABDXCTUTJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |