C10H10O5 — CID 57281930
(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid (PubChem CID 57281930) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 57281930 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](CO)c1cccc2c1OCO2 |
| InChI | InChI=1S/C10H10O5/c11-4-7(10(12)13)6-2-1-3-8-9(6)15-5-14-8/h1-3,7,11H,4-5H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | OJQPEBNDEDBSIU-ZETCQYMHSA-N |
| XLogP | 0.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |