(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid

C10H10O5 — CID 57281930

IUPAC(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid
SMILESO=C(O)[C@@H](CO)c1cccc2c1OCO2
InChIInChI=1S/C10H10O5/c11-4-7(10(12)13)6-2-1-3-8-9(6)15-5-14-8/h1-3,7,11H,4-5H2,(H,12,13)/t7-/m0/s1
InChIKeyOJQPEBNDEDBSIU-ZETCQYMHSA-N
MW210.18 g/mol
LogP0.58
Rot. Bonds3

About (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid

(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid (PubChem CID 57281930) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid.

Molecular Properties

Compound Name(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid
PubChem CID57281930
Molecular FormulaC10H10O5
Molecular Weight210.18 g/mol
Exact Mass210.05
IUPAC Name(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid
SMILESO=C(O)[C@@H](CO)c1cccc2c1OCO2
InChIInChI=1S/C10H10O5/c11-4-7(10(12)13)6-2-1-3-8-9(6)15-5-14-8/h1-3,7,11H,4-5H2,(H,12,13)/t7-/m0/s1
InChIKeyOJQPEBNDEDBSIU-ZETCQYMHSA-N
XLogP0.58
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.18
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid?
The IUPAC name of (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid (CID 57281930) is (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid.
What is the SMILES notation for (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid?
The canonical SMILES for (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid is O=C(O)[C@@H](CO)c1cccc2c1OCO2.
What is the InChIKey of (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid?
The InChIKey is OJQPEBNDEDBSIU-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H10O5/c11-4-7(10(12)13)6-2-1-3-8-9(6)15-5-14-8/h1-3,7,11H,4-5H2,(H,12,13)/t7-/m0/s1.
What are the key properties of (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid?
(2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid has a molecular weight of 210.18 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-benzodioxol-4-yl)-3-hydroxypropanoic acid is sourced from PubChem (CID 57281930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).