C9H7F5N2O4S — CID 10042482
N-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanamide (PubChem CID 10042482) has the molecular formula C9H7F5N2O4S and a molecular weight of 334.22 g/mol. Its IUPAC name is N-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 10042482 |
| Molecular Formula | C9H7F5N2O4S |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)NO |
| InChI | InChI=1S/C9H7F5N2O4S/c1-2(9(17)15-18)16-21(19,20)8-6(13)4(11)3(10)5(12)7(8)14/h2,16,18H,1H3,(H,15,17) |
| InChIKey | AUIKJLRMPLDORG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|