C9H12BrNO4S2 — CID 43090805
4-[(5-bromothiophen-2-yl)sulfonyl-methylamino]butanoic acid (PubChem CID 43090805) has the molecular formula C9H12BrNO4S2 and a molecular weight of 342.24 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)sulfonyl-methylamino]butanoic acid.
| Compound Name | 4-[(5-bromothiophen-2-yl)sulfonyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43090805 |
| Molecular Formula | C9H12BrNO4S2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)sulfonyl-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H12BrNO4S2/c1-11(6-2-3-8(12)13)17(14,15)9-5-4-7(10)16-9/h4-5H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | MJOYAGFVGYHSDS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |