C12H17NO4S2 — CID 104654990
2-[5-[methyl(pent-4-enyl)sulfamoyl]thiophen-2-yl]acetic acid (PubChem CID 104654990) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[5-[methyl(pent-4-enyl)sulfamoyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[methyl(pent-4-enyl)sulfamoyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 104654990 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[5-[methyl(pent-4-enyl)sulfamoyl]thiophen-2-yl]acetic acid |
| SMILES | C=CCCCN(C)S(=O)(=O)c1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C12H17NO4S2/c1-3-4-5-8-13(2)19(16,17)12-7-6-10(18-12)9-11(14)15/h3,6-7H,1,4-5,8-9H2,2H3,(H,14,15) |
| InChIKey | LZUTWFZFCKOOOV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|